Online Database of Chemicals from Around the World
|
CAS#: 257-05-6 Product: Benzo[b][1]Benzoxepine No suppilers available for the product. |
| Name | Benzo[b][1]Benzoxepine |
|---|---|
| Synonyms | Dibenz(B,F)Oxepin; Dibenz[B,F]Oxepin |
| Molecular Structure | ![CAS#: 257-05-6， Benzo[b][1]Benzoxepine](/moreStructures/257-05-6.gif) |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.23 |
| CAS Registry Number | 257-05-6 |
| SMILES | C1=CC=CC2=C1OC3=C(C=C2)C=CC=C3 |
| InChI | 1S/C14H10O/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)15-13/h1-10H |
| InChIKey | QQQCGYCZORNOOS-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.211°C at 760 mmHg (Cal.) |
| Flash point | 138.316°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[b][1]Benzoxepine |