| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2-Ethanediamine, sulfate |
|---|---|
| Synonyms | 2-Aminoethylammonium; Hydrogen Sulfate; 2-Aminoethylammonium Bisulfate; Ethylenediamine, Salt With Sulphuric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C2H10N2O4S |
| Molecular Weight | 158.17 |
| CAS Registry Number | 25723-52-8 |
| EINECS | 247-209-5 |
| SMILES | O=[S](O)(=O)[O-].C(C[NH3+])N |
| InChI | 1S/C2H8N2.H2O4S/c3-1-2-4;1-5(2,3)4/h1-4H2;(H2,1,2,3,4) |
| InChIKey | BNZCDZDLTIHJAC-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 1,2-Ethanediamine, sulfate |