Online Database of Chemicals from Around the World
3-(7-(2,4-Dimethoxyphenyl)-2,3,6,7-tetrahydro-(1,4)thiazepin-5-yl)-4-hydroxy-6-methylpyran-2-one
[CAS# 257292-29-8]
Identification| Name | 3-(7-(2,4-Dimethoxyphenyl)-2,3,6,7-tetrahydro-(1,4)thiazepin-5-yl)-4-hydroxy-6-methylpyran-2-one |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.44 |
| CAS Registry Number | 257292-29-8 |
| SMILES | CC1=CC(=C(C(=O)O1)C2=NCCSC(C2)C3=C(C=C(C=C3)OC)OC)O |
|
Properties
| Solubility | 2.752 mg/L (25 °C water) |
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.613, Calc.* |
| Melting point | 235.35 °C |
| Boiling Point | 525.3±50.0 °C (760 mmHg), Calc.*, 548.71 °C |
| Flash Point | 271.5±30.1 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Symbols | GHS02;GHS07 Danger Details |
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P280-P301+P312-P302+P352-P304+P340-P305+P351+P338 Details |
| SDS | Available |
|
Related Products
(1S,2R,3S)-1-(3... 1-(3,4-Dimethox... 5-[(2R)-5alpha-... (1S-(1alpha,3aa... 1-(3,4-Dimethox... 6,7-Dimethoxy-1... 6,7-Dimethoxy-4... (7S,8S,9R)-9-(3... 4-(2,4-Dimethox... 1-[4-(3,4-Dimet... 5-(3,4-Dimethox... 5-(3,4-Dimethox... 5-(3,4-Dimethox... 5-(3,4-Dimethox... 1-[[2-[5-(3,4-D... 2-[[1-(2,4-Dime... 3-(2,5-Dimethox... 2-(3,4-Dimethox... 4-(3,4-dimethox... 4-(2,4-Dimethox...