|
CAS#: 25743-56-0 Product: 4-Acetoxypropiophenone No suppilers available for the product. |
| Name | 4-Acetoxypropiophenone |
|---|---|
| Synonyms | Acetic Acid [4-(1-Oxopropyl)Phenyl] Ester; Acetic Acid (4-Propionylphenyl) Ester; (4-Propanoylphenyl) Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 |
| CAS Registry Number | 25743-56-0 |
| SMILES | C1=CC(=CC=C1C(CC)=O)OC(C)=O |
| InChI | 1S/C11H12O3/c1-3-11(13)9-4-6-10(7-5-9)14-8(2)12/h4-7H,3H2,1-2H3 |
| InChIKey | NSNRHFOGRGMKDN-UHFFFAOYSA-N |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.259°C at 760 mmHg (Cal.) |
| Flash point | 133.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Acetoxypropiophenone |