|
CAS#: 2577-52-8 Product: 4-(Dipropylsulfamoyl)-2-Nitrobenzoic Acid No suppilers available for the product. |
| Name | 4-(Dipropylsulfamoyl)-2-Nitrobenzoic Acid |
|---|---|
| Synonyms | 4-(Dipropylsulfamoyl)-2-Nitro-Benzoic Acid; 2-Nitroprobenecid; 4-((Dipropylamino)Sulfonyl)-2-Nitrobenzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18N2O6S |
| Molecular Weight | 330.36 |
| CAS Registry Number | 2577-52-8 |
| SMILES | C1=C([N+]([O-])=O)C(=CC=C1[S](=O)(=O)N(CCC)CCC)C(=O)O |
| InChI | 1S/C13H18N2O6S/c1-3-7-14(8-4-2)22(20,21)10-5-6-11(13(16)17)12(9-10)15(18)19/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17) |
| InChIKey | QVUYRWCZUQUOMI-UHFFFAOYSA-N |
| Density | 1.346g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.019°C at 760 mmHg (Cal.) |
| Flash point | 250.76°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Dipropylsulfamoyl)-2-Nitrobenzoic Acid |