Online Database of Chemicals from Around the World
| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (203) 786-5290 | |||
 |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Metabromsalan |
|---|---|
| Synonyms | 3,5-Dibromo-2-Hydroxy-N-Phenyl-Benzamide; Nsc526280; D04950 |
| Molecular Structure |  |
| Molecular Formula | C13H9Br2NO2 |
| Molecular Weight | 371.03 |
| CAS Registry Number | 2577-72-2 |
| EINECS | 219-933-1 |
| SMILES | C1=C(Br)C=C(C(=C1C(NC2=CC=CC=C2)=O)O)Br |
| InChI | 1S/C13H9Br2NO2/c14-8-6-10(12(17)11(15)7-8)13(18)16-9-4-2-1-3-5-9/h1-7,17H,(H,16,18) |
| InChIKey | YALKQBRWLMDVSA-UHFFFAOYSA-N |
| Density | 1.863g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.471°C at 760 mmHg (Cal.) |
| Flash point | 177.25°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Metabromsalan |