Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 | www.purerechem.com | |||
 | +86 (551) 6288-8437 +86 18096409024 | |||
 | info@purerechem.com | |||
 | QQ Chat | |||
 | Skype Chat | |||
 | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 3,4,6-Trichloroquinoline |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C9H4Cl3N |
| Molecular Weight | 232.49 |
| CAS Registry Number | 25771-76-0 |
| SMILES | C1=CC2=NC=C(C(=C2C=C1Cl)Cl)Cl |
| Solubility | 9.746 mg/L (25 °C water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.668, Calc.* |
| Melting point | 97.40 °C |
| Boiling Point | 316.59 °C, 303.0±37.0 °C (760 mmHg), Calc.* |
| Flash Point | 165.6±12.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 3,4,6-Trichloroquinoline |