Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-(5-Amino-2,4-Dimethylphenyl)-Benzamide |
|---|---|
| Synonyms | N-(5-Amino-2,4-Dimethyl-Phenyl)Benzamide; 2',4'-Benzoxylidide, 5'-Amino- (8Ci); 5'-Amino-2',4'-Dimethylbenzanilide |
| Molecular Structure |  |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30 |
| CAS Registry Number | 2580-80-5 |
| EINECS | 219-950-4 |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=C(C=C(C(=C2)N)C)C |
| InChI | 1S/C15H16N2O/c1-10-8-11(2)14(9-13(10)16)17-15(18)12-6-4-3-5-7-12/h3-9H,16H2,1-2H3,(H,17,18) |
| InChIKey | LCLCQESZDBITBF-UHFFFAOYSA-N |
| Density | 1.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.816°C at 760 mmHg (Cal.) |
| Flash point | 152.663°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(5-Amino-2,4-Dimethylphenyl)-Benzamide |