Online Database of Chemicals from Around the World
|
CAS#: 25826-31-7 Product: N-Butoxy-4-Methoxynaphthoimide No suppilers available for the product. |
| Name | N-Butoxy-4-Methoxynaphthoimide |
|---|---|
| Synonyms | N-Butoxy-4-Methoxynaphthoimide |
| Molecular Structure |  |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 |
| CAS Registry Number | 25826-31-7 |
| EINECS | 247-286-5 |
| SMILES | C3=C1C(N(C(C2=C1C(=CC=C2)C(=C3)OC)=O)OCCCC)=O |
| InChI | 1S/C17H17NO4/c1-3-4-10-22-18-16(19)12-7-5-6-11-14(21-2)9-8-13(15(11)12)17(18)20/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | AABXRMHVHPQKKP-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.156°C at 760 mmHg (Cal.) |
| Flash point | 245.399°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Butoxy-4-Methoxynaphthoimide |