Online Database of Chemicals from Around the World
|
CAS#: 25872-00-8 Product: (E)-beta-Chloro-4'-Iodoacrylophenone No suppilers available for the product. |
| Name | (E)-beta-Chloro-4'-Iodoacrylophenone |
|---|---|
| Synonyms | Acrylophenone, 3-Chloro-4'-Iodo-, (E)-; Trans-3-Chloro-4'-Iodoacrylophenone |
| Molecular Structure |  |
| Molecular Formula | C9H6ClIO |
| Molecular Weight | 292.50 |
| CAS Registry Number | 25872-00-8 |
| SMILES | C1=C(C(\C=C\Cl)=O)C=CC(=C1)I |
| InChI | 1S/C9H6ClIO/c10-6-5-9(12)7-1-3-8(11)4-2-7/h1-6H/b6-5+ |
| InChIKey | JDDMSOFLSWIWJQ-AATRIKPKSA-N |
| Density | 1.778g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.406°C at 760 mmHg (Cal.) |
| Flash point | 145.157°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-beta-Chloro-4'-Iodoacrylophenone |