Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (2H4)-3-Pyridinylmethanol |
|---|---|
| Synonyms | 3-PYRIDINE-METHANOL-D4 |
| Molecular Structure |  |
| Molecular Formula | C6H3D4NO |
| Molecular Weight | 113.15 |
| CAS Registry Number | 258854-74-9 |
| SMILES | [2H]c1c(c([2H])nc([2H])c1[2H])CO |
| InChI | 1S/C6H7NO/c8-5-6-2-1-3-7-4-6/h1-4,8H,5H2/i1D,2D,3D,4D |
| InChIKey | MVQVNTPHUGQQHK-RHQRLBAQSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.999°C at 760 mmHg (Cal.) |
| Flash point | 97.505°C (Cal.) |
| Refractive index | 1.551 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2H4)-3-Pyridinylmethanol |