Online Database of Chemicals from Around the World
| Name | 2,5-Dimercaptoterephthalic Acid |
|---|---|
| Synonyms | 2,5-Dimercaptoterephthalic Acid; 1,4-Benzenedicarboxylic Acid, 2,5-Dimercapto- |
| Molecular Structure |  |
| Molecular Formula | C8H6O4S2 |
| Molecular Weight | 230.25 |
| CAS Registry Number | 25906-66-5 |
| EINECS | 247-330-3 |
| SMILES | C1=C(S)C(=CC(=C1C(=O)O)S)C(=O)O |
| InChI | 1S/C8H6O4S2/c9-7(10)3-1-5(13)4(8(11)12)2-6(3)14/h1-2,13-14H,(H,9,10)(H,11,12) |
| InChIKey | YYGZWQNDFRCZIF-UHFFFAOYSA-N |
| Density | 1.648g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.689°C at 760 mmHg (Cal.) |
| Flash point | 237.255°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimercaptoterephthalic Acid |
