|
CAS#: 25909-66-4 Product: Diethyl 4,4'-[1,2-Ethanediylbis(Oxy)]Dibenzoate No suppilers available for the product. |
| Name | Diethyl 4,4'-[1,2-Ethanediylbis(Oxy)]Dibenzoate |
|---|---|
| Synonyms | Ethylene Glycol Bis[4-(ethoxycarbonyl)phenyl] Ether |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 |
| CAS Registry Number | 25909-66-4 |
| SMILES | O=C(OCC)c2ccc(OCCOc1ccc(cc1)C(=O)OCC)cc2 |
| InChI | 1S/C20H22O6/c1-3-23-19(21)15-5-9-17(10-6-15)25-13-14-26-18-11-7-16(8-12-18)20(22)24-4-2/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | XTHNYIOBLBKRMO-UHFFFAOYSA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Melting point | 108°C (Expl.) |
| Boiling point | 496.05°C at 760 mmHg (Cal.) |
| Flash point | 216.631°C (Cal.) |
| Refractive index | 1.541 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Diethyl 4,4'-[1,2-Ethanediylbis(Oxy)]Dibenzoate |