|
CAS#: 2591-11-9 Product: 2-Ethylsulfonyl-1,3-Benzothiazole No suppilers available for the product. |
| Name | 2-Ethylsulfonyl-1,3-Benzothiazole |
|---|---|
| Synonyms | Benzothiazole, Ethylsulfonyl-; Ethyl 2-Benzothiazyl Sulfone; Ethylsulfonylbenzothiazole |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO2S2 |
| Molecular Weight | 227.30 |
| CAS Registry Number | 2591-11-9 |
| SMILES | C2=C1SC(=NC1=CC=C2)[S](=O)(=O)CC |
| InChI | 1S/C9H9NO2S2/c1-2-14(11,12)9-10-7-5-3-4-6-8(7)13-9/h3-6H,2H2,1H3 |
| InChIKey | ZYGPCLHWVYJMPA-UHFFFAOYSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.006°C at 760 mmHg (Cal.) |
| Flash point | 181.807°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethylsulfonyl-1,3-Benzothiazole |