| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Amino acid salt |
|---|---|
| Name | Ethyl (1R,2S)-1-Amino-2-Vinyl-Cyclopropanecarboxylate Hydrochloride |
| Synonyms | (1R,2S)-e |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14ClNO2 |
| Molecular Weight | 191.65 |
| CAS Registry Number | 259214-54-5 |
| SMILES | CCOC(=O)[C@]1(C[C@H]1C=C)N.Cl |
| InChI | 1S/C8H13NO2.ClH/c1-3-6-5-8(6,9)7(10)11-4-2;/h3,6H,1,4-5,9H2,2H3;1H/t6-,8-;/m1./s1 |
| InChIKey | RSBFMCGEQFBZBE-CIRBGYJCSA-N |
| Refractive index | (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ethyl (1R,2S)-1-Amino-2-Vinyl-Cyclopropanecarboxylate Hydrochloride |