Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-(6-Aminohexyl)-9-Acridinecarboxamide |
|---|---|
| Synonyms | 9-ACRIDINECARBOXAMIDE,N-(6-AMINOHEXYL)-; N-(6-Aminohexyl)acridine-9-carboxamide |
| Molecular Structure |  |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 |
| CAS Registry Number | 259221-99-3 |
| SMILES | O=C(c1c3c(nc2c1cccc2)cccc3)NCCCCCCN |
| InChI | 1S/C20H23N3O/c21-13-7-1-2-8-14-22-20(24)19-15-9-3-5-11-17(15)23-18-12-6-4-10-16(18)19/h3-6,9-12H,1-2,7-8,13-14,21H2,(H,22,24) |
| InChIKey | PGVOZVNUQGIFDY-UHFFFAOYSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 595.436°C at 760 mmHg (Cal.) |
| Flash point | 313.908°C (Cal.) |
| Refractive index | 1.643 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(6-Aminohexyl)-9-Acridinecarboxamide |