Online Database of Chemicals from Around the World
|
CAS#: 25956-55-2 Product: 2-(Phosphonooxy)-2-Butenoic acid No suppilers available for the product. |
| Name | 2-(Phosphonooxy)-2-Butenoic acid |
|---|---|
| Synonyms | Phosphoenol-2-Ketobutyrate; Phosphoenol-Alpha-Ketobutyrate; 2-Butenoic Acid, 2-(Phosphonooxy)- |
| Molecular Structure |  |
| Molecular Formula | C4H7O6P |
| Molecular Weight | 182.07 |
| CAS Registry Number | 25956-55-2 |
| SMILES | C/C=C(O[P](=O)(O)O)/C(=O)O |
| InChI | 1S/C4H7O6P/c1-2-3(4(5)6)10-11(7,8)9/h2H,1H3,(H,5,6)(H2,7,8,9)/b3-2- |
| InChIKey | FGYIHYXZLMDROB-IHWYPQMZSA-N |
| Density | 1.684g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.93°C at 760 mmHg (Cal.) |
| Flash point | 229.538°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Phosphonooxy)-2-Butenoic acid |