|
CAS#: 25963-47-7 Product: 4-[(4-Aminophenyl)Sulphonyl]Phenol No suppilers available for the product. |
| Name | 4-[(4-Aminophenyl)Sulphonyl]Phenol |
|---|---|
| Synonyms | Aids-020172; Aids020172; P-Sulfanilylphenol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.28 |
| CAS Registry Number | 25963-47-7 |
| EINECS | 247-378-5 |
| SMILES | C1=C(C=CC(=C1)O)[S](=O)(=O)C2=CC=C(C=C2)N |
| InChI | 1S/C12H11NO3S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8,14H,13H2 |
| InChIKey | PSHPCZGANRRQDN-UHFFFAOYSA-N |
| Density | 1.397g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.45°C at 760 mmHg (Cal.) |
| Flash point | 261.302°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Aminophenyl)Sulphonyl]Phenol |