|
CAS#: 25979-01-5 Product: 4-[(Pentafluoroethyl)Sulfanyl]Biphenyl No suppilers available for the product. |
| Name | 4-[(Pentafluoroethyl)Sulfanyl]Biphenyl |
|---|---|
| Synonyms | 4-Pentafluoroethylsulfanyl-biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9F5S |
| Molecular Weight | 304.28 |
| CAS Registry Number | 25979-01-5 |
| SMILES | c1ccc(cc1)c2ccc(cc2)SC(C(F)(F)F)(F)F |
| InChI | 1S/C14H9F5S/c15-13(16,17)14(18,19)20-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | QQAVJMFRZDYJQK-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.484°C at 760 mmHg (Cal.) |
| Flash point | 123.433°C (Cal.) |
| Refractive index | 1.533 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(Pentafluoroethyl)Sulfanyl]Biphenyl |