|
CAS#: 2606-63-5 Product: Tris(3-Methylphenyl)Arsine No suppilers available for the product. |
| Name | Tris(3-Methylphenyl)Arsine |
|---|---|
| Synonyms | Arsine, tris(3-methylphenyl)-; Tris(3-methylphenyl)arsin; Tris(3-methylphenyl)arsine |
| Molecular Structure | ![]() |
| Molecular Formula | C21H21As |
| Molecular Weight | 348.31 |
| CAS Registry Number | 2606-63-5 |
| SMILES | Cc1cccc(c1)[As](c2cccc(c2)C)c3cccc(c3)C |
| InChI | 1S/C21H21As/c1-16-7-4-10-19(13-16)22(20-11-5-8-17(2)14-20)21-12-6-9-18(3)15-21/h4-15H,1-3H3 |
| InChIKey | HTNUTGWZKFWGTF-UHFFFAOYSA-N |
| Boiling point | 435.0±45.0°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 214.6±22.9°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(3-Methylphenyl)Arsine |