|
CAS#: 261360-70-7 Product: 4-Isopropyl-N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-Phenylalanine No suppilers available for the product. |
| Name | 4-Isopropyl-N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-Phenylalanine |
|---|---|
| Synonyms | (S)-2-ter |
| Molecular Structure | ![]() |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.38 |
| CAS Registry Number | 261360-70-7 |
| SMILES | CC(C)c1ccc(cc1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
| InChI | 1S/C17H25NO4/c1-11(2)13-8-6-12(7-9-13)10-14(15(19)20)18-16(21)22-17(3,4)5/h6-9,11,14H,10H2,1-5H3,(H,18,21)(H,19,20)/t14-/m0/s1 |
| InChIKey | DAHLPTAIXLYVQD-AWEZNQCLSA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.604°C at 760 mmHg (Cal.) |
| Flash point | 229.341°C (Cal.) |
| Refractive index | 1.519 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Isopropyl-N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-Phenylalanine |