Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-4-Phenyl-2-Piperidinecarboxylic Acid |
|---|---|
| Synonyms | 1-(tert-butoxycarbonyl)-4-phenylpiperidine-2-carboxylic acid; 4-Phenyl-piperidine-1,2-dicarboxylic acid 1-tert-butyl ester |
| Molecular Structure | ![CAS#: 261777-31-5， 1-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-4-Phenyl-2-Piperidinecarboxylic Acid](/moreStructures/261777-31-5.gif) |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 |
| CAS Registry Number | 261777-31-5 |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1C(=O)O)c2ccccc2 |
| InChI | 1S/C17H23NO4/c1-17(2,3)22-16(21)18-10-9-13(11-14(18)15(19)20)12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3,(H,19,20) |
| InChIKey | DAYGDJLPGZOFEW-UHFFFAOYSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.872°C at 760 mmHg (Cal.) |
| Flash point | 228.899°C (Cal.) |
| Refractive index | 1.54 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-4-Phenyl-2-Piperidinecarboxylic Acid |