Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-(2,5-Dichlorophenyl)-Acetamide |
|---|---|
| Synonyms | N-(2,5-Dichlorophenyl)Ethanamide; Zinc00394183; St5437320 |
| Molecular Structure |  |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.06 |
| CAS Registry Number | 2621-62-7 |
| EINECS | 220-062-4 |
| SMILES | C1=C(Cl)C=CC(=C1NC(C)=O)Cl |
| InChI | 1S/C8H7Cl2NO/c1-5(12)11-8-4-6(9)2-3-7(8)10/h2-4H,1H3,(H,11,12) |
| InChIKey | ICZFWTSENFTULW-UHFFFAOYSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Melting point | 135°C (Expl.) |
| Boiling point | 346.185°C at 760 mmHg (Cal.) |
| Flash point | 163.167°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(2,5-Dichlorophenyl)-Acetamide |