Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (803) 788-9494 | |||
|
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Name | N-(4-Chlorophenyl)-Carbamic Acid Ethyl Ester |
|---|---|
| Synonyms | N-(4-Chlorophenyl)Carbamic Acid Ethyl Ester; 4-Chlorophenylurethane; Ai3-51956 |
| Molecular Structure |  |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 |
| CAS Registry Number | 2621-80-9 |
| SMILES | C1=C(NC(OCC)=O)C=CC(=C1)Cl |
| InChI | 1S/C9H10ClNO2/c1-2-13-9(12)11-8-5-3-7(10)4-6-8/h3-6H,2H2,1H3,(H,11,12) |
| InChIKey | WSKXXIMERYQVGJ-UHFFFAOYSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Melting point | 64-66°C (Expl.) |
| Boiling point | 240.03°C at 760 mmHg (Cal.) |
| Flash point | 98.967°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(4-Chlorophenyl)-Carbamic Acid Ethyl Ester |