Online Database of Chemicals from Around the World
|
CAS#: 26259-90-5 Product: 1-(Trichloromethylthio)-4-Methyl-1H-Pyrazole No suppilers available for the product. |
| Name | 1-(Trichloromethylthio)-4-Methyl-1H-Pyrazole |
|---|---|
| Synonyms | 4-Methyl-1-(Trichloromethylthio)Pyrazole; 1-(Trichloromethylmercapto)-4-Methylpyrazole; Pyrazole, 4-Methyl-1-((Trichloromethyl)Thio)- |
| Molecular Structure |  |
| Molecular Formula | C5H5Cl3N2S |
| Molecular Weight | 231.53 |
| CAS Registry Number | 26259-90-5 |
| SMILES | C1=C(C=N[N]1SC(Cl)(Cl)Cl)C |
| InChI | 1S/C5H5Cl3N2S/c1-4-2-9-10(3-4)11-5(6,7)8/h2-3H,1H3 |
| InChIKey | HAFGIUUKMOFFKM-UHFFFAOYSA-N |
| Density | 1.576g/cm3 (Cal.) |
|---|---|
| Boiling point | 222.043°C at 760 mmHg (Cal.) |
| Flash point | 88.089°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Trichloromethylthio)-4-Methyl-1H-Pyrazole |