Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
|
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 5-Amino-5-Deoxy-alpha-D-Ribofuranoside |
|---|---|
| Synonyms | (2R,3S,4R |
| Molecular Structure |  |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 |
| CAS Registry Number | 262600-85-1 |
| SMILES | O[C@@H]1[C@@H](CN)O[C@H](OC)[C@@H]1O |
| InChI | 1S/C6H13NO4/c1-10-6-5(9)4(8)3(2-7)11-6/h3-6,8-9H,2,7H2,1H3/t3-,4-,5-,6+/m1/s1 |
| InChIKey | ODOKPZPCULYXKR-KAZBKCHUSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.783°C at 760 mmHg (Cal.) |
| Flash point | 151.433°C (Cal.) |
| Refractive index | 1.525 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 5-Amino-5-Deoxy-alpha-D-Ribofuranoside |