Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3-Ethyl-1-Methyl-4-Nitro-1H-Pyrazole-5-Carboxylic Acid |
|---|---|
| Synonyms | 3-Ethyl-1-methyl-4-nitro-1H-pyrazole-5-carboxylicacid; 5-Ethyl-2-methyl-4-nitro-2 H -pyrazole-3-carboxyli; 5-Ethyl-2-methyl-4-nitro-2 H -pyrazole-3-carboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.16 |
| CAS Registry Number | 26308-41-8 |
| SMILES | O=C(O)c1c([N+]([O-])=O)c(nn1C)CC |
| InChI | 1S/C7H9N3O4/c1-3-4-5(10(13)14)6(7(11)12)9(2)8-4/h3H2,1-2H3,(H,11,12) |
| InChIKey | NWFDDRJCLWSJNP-UHFFFAOYSA-N |
| Density | 1.526g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.294°C at 760 mmHg (Cal.) |
| Flash point | 187.424°C (Cal.) |
| Refractive index | 1.627 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-1-Methyl-4-Nitro-1H-Pyrazole-5-Carboxylic Acid |