Online Database of Chemicals from Around the World
|
CAS#: 2633-01-4 Product: Di(Pyridin-3-Yl)Diazene No suppilers available for the product. |
| Name | Di(Pyridin-3-Yl)Diazene |
|---|---|
| Synonyms | Bis(3-Pyridyl)Diazene; 3-Azopyridine; Pyridine, 3,3'-Azobis- |
| Molecular Structure |  |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 |
| CAS Registry Number | 2633-01-4 |
| SMILES | C2=C(N=NC1=CC=CN=C1)C=NC=C2 |
| InChI | 1S/C10H8N4/c1-3-9(7-11-5-1)13-14-10-4-2-6-12-8-10/h1-8H |
| InChIKey | YKROEKFLSMDUSV-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.852°C at 760 mmHg (Cal.) |
| Flash point | 162.361°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di(Pyridin-3-Yl)Diazene |