Online Database of Chemicals from Around the World
| Name | 2,4,6-Trichlororesorcinol |
|---|---|
| Synonyms | 2,4,6-Trichlororesorcinol; 1,3-Benzenediol, 2,4,6-Trichloro-; Nsc36930 |
| Molecular Structure |  |
| Molecular Formula | C6H3Cl3O2 |
| Molecular Weight | 213.45 |
| CAS Registry Number | 26378-73-4 |
| EINECS | 247-639-3 |
| SMILES | C1=C(C(=C(C(=C1Cl)O)Cl)O)Cl |
| InChI | 1S/C6H3Cl3O2/c7-2-1-3(8)6(11)4(9)5(2)10/h1,10-11H |
| InChIKey | NHOATJNESSAPCQ-UHFFFAOYSA-N |
| Density | 1.748g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.92°C at 760 mmHg (Cal.) |
| Flash point | 114.625°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Trichlororesorcinol |
