Online Database of Chemicals from Around the World
|
CAS#: 2639-53-4 Product: 5a-Androstan-2-en-17b-ol No suppilers available for the product. |
| Name | 5a-Androstan-2-en-17b-ol |
|---|---|
| Synonyms | 17Beta-Hydroxy-5Alpha-Androst-2-Ene; 5Alpha-Androstan-2-En-17Beta-Ol; C15298 |
| Molecular Structure |  |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 |
| CAS Registry Number | 2639-53-4 |
| SMILES | [C@@H]4(O)[C@]3(CC[C@@H]2[C@]1(CC=CC[C@@H]1CC[C@H]2[C@@H]3CC4)C)C |
| InChI | 1S/C19H30O/c1-18-11-4-3-5-13(18)6-7-14-15-8-9-17(20)19(15,2)12-10-16(14)18/h3-4,13-17,20H,5-12H2,1-2H3/t13-,14+,15+,16+,17+,18+,19+/m1/s1 |
| InChIKey | FEOWWOCANLUVIT-KYQPOWKGSA-N |
| Density | 1.038g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.067°C at 760 mmHg (Cal.) |
| Flash point | 156.494°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5a-Androstan-2-en-17b-ol |