| Creative Peptides | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 624-4882 | |||
![]() |
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Glycine derivatives |
|---|---|
| Name | N-Furylacryloylglycyl-L-leucinamide |
| Synonyms | (2S)-2-[[2-(3-Furan-2-Ylprop-2-Enoylamino)Acetyl]Amino]-4-Methylpentanamide; (2S)-2-[[2-[3-(2-Furyl)Prop-2-Enoylamino]Acetyl]Amino]-4-Methyl-Pentanamide; (2S)-2-[[2-[[(E)-3-(2-Furyl)Prop-2-Enoyl]Amino]Acetyl]Amino]-4-Methyl-Pentanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 |
| CAS Registry Number | 26400-33-9 |
| SMILES | [C@@H](NC(=O)CNC(=O)/C=C/C1=CC=CO1)(C(=O)N)CC(C)C |
| InChI | 1S/C15H21N3O4/c1-10(2)8-12(15(16)21)18-14(20)9-17-13(19)6-5-11-4-3-7-22-11/h3-7,10,12H,8-9H2,1-2H3,(H2,16,21)(H,17,19)(H,18,20)/b6-5+/t12-/m0/s1 |
| InChIKey | JRGRHYPAYAJGAF-FYJFLYSWSA-N |
| Protein Sequence | FA-Gly-Leu-NH2 |
| Density | 1.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 639.718°C at 760 mmHg (Cal.) |
| Flash point | 340.689°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Furylacryloylglycyl-L-leucinamide |