Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Creative Peptides | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 624-4882 | |||
|
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-[(2E)-3-(2-Furyl)-2-Propenoyl]Glycyl-L-Phenylalaninamide |
|---|---|
| Synonyms | FA-GLY-PHE-NH2; ZINC02572086 |
| Molecular Structure | ![CAS#: 26400-34-0， N-[(2E)-3-(2-Furyl)-2-Propenoyl]Glycyl-L-Phenylalaninamide](/moreStructures/26400-34-0.gif) |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.36 |
| CAS Registry Number | 26400-34-0 |
| SMILES | O=C(\C=C\c1occc1)NCC(=O)N[C@H](C(=O)N)Cc2ccccc2 |
| InChI | 1S/C18H19N3O4/c19-18(24)15(11-13-5-2-1-3-6-13)21-17(23)12-20-16(22)9-8-14-7-4-10-25-14/h1-10,15H,11-12H2,(H2,19,24)(H,20,22)(H,21,23)/b9-8+/t15-/m0/s1 |
| InChIKey | VWWNVBHNYLBUSY-HVHJFMEUSA-N |
| Protein Sequence | FA-Gly-Phe-NH2 |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 727.851°C at 760 mmHg (Cal.) |
| Flash point | 393.99°C (Cal.) |
| Refractive index | 1.605 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(2E)-3-(2-Furyl)-2-Propenoyl]Glycyl-L-Phenylalaninamide |