Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl (1S,2R)-2-Vinylcyclobutanecarboxylate |
|---|---|
| Synonyms | (1S,2R)-ethyl 2-vinylcyclobutanecarboxylate |
| Molecular Structure |  |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 |
| CAS Registry Number | 264614-04-2 |
| SMILES | CCOC(=O)[C@H]1CC[C@@H]1C=C |
| InChI | 1S/C9H14O2/c1-3-7-5-6-8(7)9(10)11-4-2/h3,7-8H,1,4-6H2,2H3/t7-,8-/m0/s1 |
| InChIKey | OSRFZPIIRGAROG-YUMQZZPRSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 180.735°C at 760 mmHg (Cal.) |
| Flash point | 53.12°C (Cal.) |
| Refractive index | 1.526 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (1S,2R)-2-Vinylcyclobutanecarboxylate |