| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Fosaprepitant Dibenzyl Ester Impurity |
|---|---|
| Synonyms | 2-bis(phenylmethoxy)phosphoryl-5-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-4H-1,2,4-triazol-3-one |
| Molecular Structure | ![]() |
| Molecular Formula | C37H34F7N4O6P |
| Molecular Weight | 794.65 |
| CAS Registry Number | 265121-01-5 |
| SMILES | C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2[C@@H](N(CCO2)CC3=NN(C(=O)N3)P(=O)(OCC4=CC=CC=C4)OCC5=CC=CC=C5)C6=CC=C(C=C6)F |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.582, Calc.* |
| Boiling Point | 697.9±65.0 °C (760 mmHg), Calc.* |
| Flash Point | 375.9±34.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Fosaprepitant Dibenzyl Ester Impurity |