|
CAS#: 26526-49-8 Product: 2-Formyl-1-Benzoselenophene-3-Carboxylic Acid No suppilers available for the product. |
| Name | 2-Formyl-1-Benzoselenophene-3-Carboxylic Acid |
|---|---|
| Synonyms | 2-Formyl-1-benzoselenophene-3-carboxylic acid; 2-Formyl-1-benzoselenophene-3-carboxylic acid #; Benzo[b]selenophene-3-carboxylic acid, 2-formyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6O3Se |
| Molecular Weight | 253.11 |
| CAS Registry Number | 26526-49-8 |
| SMILES | O=C(O)c1c2ccccc2[se]c1C=O |
| InChI | 1S/C10H6O3Se/c11-5-8-9(10(12)13)6-3-1-2-4-7(6)14-8/h1-5H,(H,12,13) |
| InChIKey | TWHAIMHYWDXPLD-UHFFFAOYSA-N |
| Boiling point | 447.797°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 224.62°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Formyl-1-Benzoselenophene-3-Carboxylic Acid |