Online Database of Chemicals from Around the World
|
CAS#: 26531-85-1 Product: 6-O-beta-D-Xylopyranosyl-D-Glucose No suppilers available for the product. |
| Name | 6-O-beta-D-Xylopyranosyl-D-Glucose |
|---|---|
| Synonyms | (3R,4S,5S,6R)-6-[[(2S,3R,4S,5R)-3,4,5-Trihydroxytetrahydropyran-2-Yl]Oxymethyl]Tetrahydropyran-2,3,4,5-Tetrol; (3R,4S,5S,6R)-6-[[(2S,3R,4S,5R)-3,4,5-Trihydroxy-2-Tetrahydropyranyl]Oxymethyl]Tetrahydropyran-2,3,4,5-Tetrol; 6-O-Beta-D-Xylopyranosyl-D-Glucose |
| Molecular Structure |  |
| Molecular Formula | C11H20O10 |
| Molecular Weight | 312.27 |
| CAS Registry Number | 26531-85-1 |
| SMILES | [C@H]1([C@H]([C@H](O)[C@H](OC1O)CO[C@H]2[C@@H]([C@@H](O)[C@@H](CO2)O)O)O)O |
| InChI | 1S/C11H20O10/c12-3-1-19-11(9(17)5(3)13)20-2-4-6(14)7(15)8(16)10(18)21-4/h3-18H,1-2H2/t3-,4-,5+,6-,7+,8-,9-,10?,11+/m1/s1 |
| InChIKey | QYNRIDLOTGRNML-XJBKZTKUSA-N |
| Density | 1.74g/cm3 (Cal.) |
|---|---|
| Boiling point | 608.397°C at 760 mmHg (Cal.) |
| Flash point | 321.747°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-O-beta-D-Xylopyranosyl-D-Glucose |