Online Database of Chemicals from Around the World
|
CAS#: 26541-57-1 Product: 2-(N-Acetyloxy-N-Acetylamino)Phenanthrene No suppilers available for the product. |
| Name | 2-(N-Acetyloxy-N-Acetylamino)Phenanthrene |
|---|---|
| Synonyms | (Acetyl-(2-Phenanthryl)Amino) Acetate; Acetic Acid (Acetyl-(2-Phenanthryl)Amino) Ester; (Ethanoyl-Phenanthren-2-Yl-Amino) Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 |
| CAS Registry Number | 26541-57-1 |
| SMILES | C1=CC(=CC2=C1C3=C(C=C2)C=CC=C3)N(OC(C)=O)C(C)=O |
| InChI | 1S/C18H15NO3/c1-12(20)19(22-13(2)21)16-9-10-18-15(11-16)8-7-14-5-3-4-6-17(14)18/h3-11H,1-2H3 |
| InChIKey | PBUJMRDTXSUQHF-UHFFFAOYSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.251°C at 760 mmHg (Cal.) |
| Flash point | 235.176°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(N-Acetyloxy-N-Acetylamino)Phenanthrene |