Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-Acetyl-3,5-Difluorophenylalanine |
|---|---|
| Synonyms | 2-Acetylamino-3-(3,5-difluoro-phenyl)-propionic acid; D-PHENYLALANINE,N-ACETYL-3,5-DIFLUORO-; N-Acetyl-3-(3,5-difluorophenyl)-DL-alanine |
| Molecular Structure |  |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 |
| CAS Registry Number | 266360-52-5 |
| SMILES | Fc1cc(cc(F)c1)CC(C(=O)O)NC(=O)C |
| InChI | 1S/C11H11F2NO3/c1-6(15)14-10(11(16)17)4-7-2-8(12)5-9(13)3-7/h2-3,5,10H,4H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | WAJHNNVGLZYPIO-UHFFFAOYSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.617°C at 760 mmHg (Cal.) |
| Flash point | 219.068°C (Cal.) |
| Refractive index | 1.517 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-3,5-Difluorophenylalanine |