Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Ethyl 2-[4-(2-Methoxyphenyl)Phenyl]Acetate |
|---|---|
| Synonyms | (2'-Methoxy-biphenyl-4-yl)-acetic acid ethyl ester; [1,1'-BIPHENYL]-4-ACETICACID, 2'-METHOXY-, ETHYL ESTER; ETHYL(2-METHOXY-BIPHENYL-4-YL)-ACETATE |
| Molecular Structure | ![CAS#: 266370-57-4， Ethyl 2-[4-(2-Methoxyphenyl)Phenyl]Acetate](/moreStructures/266370-57-4.gif) |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32 |
| CAS Registry Number | 266370-57-4 |
| SMILES | COc2ccccc2c1ccc(CC(=O)OCC)cc1 |
| InChI | 1S/C17H18O3/c1-3-20-17(18)12-13-8-10-14(11-9-13)15-6-4-5-7-16(15)19-2/h4-11H,3,12H2,1-2H3 |
| InChIKey | VVSNUNWAIOJIGZ-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.925°C at 760 mmHg (Cal.) |
| Flash point | 152.091°C (Cal.) |
| Refractive index | 1.542 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-[4-(2-Methoxyphenyl)Phenyl]Acetate |