| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,4-Dichloro-6-Propoxy-1,3,5-Triazine |
|---|---|
| Synonyms | 2,4-Dichloro-6-Propoxy-S-Triazine; Zinc02012877 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7Cl2N3O |
| Molecular Weight | 208.05 |
| CAS Registry Number | 26650-75-9 |
| EINECS | 247-875-7 |
| SMILES | C(OC1=NC(=NC(=N1)Cl)Cl)CC |
| InChI | 1S/C6H7Cl2N3O/c1-2-3-12-6-10-4(7)9-5(8)11-6/h2-3H2,1H3 |
| InChIKey | SVHHRUHQFRFOIQ-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.1±25.0°C at 760 mmHg (Cal.) |
| Flash point | 164.3±23.2°C (Cal.) |
| 110°C (Expl.) | |
| Refractive index | 1.5135 (Expl.) |
| Safety Code | S26;S36/37/39;S45 Details |
|---|---|
| Risk Code | R34 Details |
| Hazard Symbol | C Details |
| Transport Information | UN3265 |
| Safety Description | DANGER: CORROSIVE, burns skin and eyes |
| CORROSIVE | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichloro-6-Propoxy-1,3,5-Triazine |