Online Database of Chemicals from Around the World
|
CAS#: 2666-70-8 Product: 1,1-Dichloro-N-(2,4-Dichlorophenyl)Methanimine No suppilers available for the product. |
| Name | 1,1-Dichloro-N-(2,4-Dichlorophenyl)Methanimine |
|---|---|
| Synonyms | Dichloromethylene-(2,4-Dichlorophenyl)Amine; (2,4-Dichlorophenyl)Imidocarbonyl Dichloride |
| Molecular Structure |  |
| Molecular Formula | C7H3Cl4N |
| Molecular Weight | 242.92 |
| CAS Registry Number | 2666-70-8 |
| EINECS | 220-202-4 |
| SMILES | C1=C(N=C(Cl)Cl)C(=CC(=C1)Cl)Cl |
| InChI | 1S/C7H3Cl4N/c8-4-1-2-6(5(9)3-4)12-7(10)11/h1-3H |
| InChIKey | DXSAVHVNRZIEGB-UHFFFAOYSA-N |
| Density | 1.531g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.222°C at 760 mmHg (Cal.) |
| Flash point | 131.741°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dichloro-N-(2,4-Dichlorophenyl)Methanimine |