|
CAS#: 26718-25-2 Product: Halofenate No suppilers available for the product. |
| Name | Halofenate |
|---|---|
| Synonyms | 2-(4-Chlorophenyl)-2-[3-(Trifluoromethyl)Phenoxy]Acetic Acid 2-Acetamidoethyl Ester; 2-Acetamidoethyl 2-(4-Chlorophenyl)-2-[3-(Trifluoromethyl)Phenoxy]Ethanoate; Mk-185 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H17ClF3NO4 |
| Molecular Weight | 415.80 |
| CAS Registry Number | 26718-25-2 |
| SMILES | C2=C(C(OC1=CC=CC(=C1)C(F)(F)F)C(OCCNC(C)=O)=O)C=CC(=C2)Cl |
| InChI | 1S/C19H17ClF3NO4/c1-12(25)24-9-10-27-18(26)17(13-5-7-15(20)8-6-13)28-16-4-2-3-14(11-16)19(21,22)23/h2-8,11,17H,9-10H2,1H3,(H,24,25) |
| InChIKey | BJBCSGQLZQGGIQ-UHFFFAOYSA-N |
| Density | 1.331g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.053°C at 760 mmHg (Cal.) |
| Flash point | 287.067°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Halofenate |