Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (571) 8708-6220 | |||
|
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | Ethyl (2Z)-2-[(Dimethylamino)Methylene]-4,4,4-Trifluoro-3-Oxobutanoate |
|---|---|
| Synonyms | ethyl 2-trifluoroacetyl-3-(N,N-dimethylamino)-2-propenoate; TL8002125 |
| Molecular Structure | ![CAS#: 267243-86-7， Ethyl (2Z)-2-[(Dimethylamino)Methylene]-4,4,4-Trifluoro-3-Oxobutanoate](/moreStructures/267243-86-7.gif) |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 |
| CAS Registry Number | 267243-86-7 |
| SMILES | O=C(/C(=C/N(C)C)C(=O)OCC)C(F)(F)F |
| InChI | 1S/C9H12F3NO3/c1-4-16-8(15)6(5-13(2)3)7(14)9(10,11)12/h5H,4H2,1-3H3/b6-5- |
| InChIKey | JXBLPDIZGMZWNB-WAYWQWQTSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 194.516°C at 760 mmHg (Cal.) |
| Flash point | 71.441°C (Cal.) |
| Refractive index | 1.423 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2Z)-2-[(Dimethylamino)Methylene]-4,4,4-Trifluoro-3-Oxobutanoate |