Online Database of Chemicals from Around the World
|
CAS#: 26810-97-9 Product: 1,3,5-Cycloheptatrienylium Hexachloroantimonate(1-) No suppilers available for the product. |
| Name | 1,3,5-Cycloheptatrienylium Hexachloroantimonate(1-) |
|---|---|
| Synonyms | cycloheptatrienylium hexachloroantimonate(1-) |
| Molecular Structure |  |
| Molecular Formula | C7H7Cl6Sb |
| Molecular Weight | 425.61 |
| CAS Registry Number | 26810-97-9 |
| EINECS | 248-013-2 |
| SMILES | Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl.C=1C=[C+]CC=CC=1 |
| InChI | 1S/C7H7.6ClH.Sb/c1-2-4-6-7-5-3-1;;;;;;;/h1-5H,6H2;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | OKEPGJWIIBYKLG-UHFFFAOYSA-H |
| Refractive index | (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Cycloheptatrienylium Hexachloroantimonate(1-) |