| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 3-((2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl)propanamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 |
| CAS Registry Number | 268221-76-7 |
| SMILES | C[C@H]1C(=O)N[C@H](C(=O)N1)CCC(=O)N |
| Solubility | 1 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.484, Calc.* |
| Melting point | 215.03 °C |
| Boiling Point | 505.20 °C, 670.3±40.0 °C (760 mmHg), Calc.* |
| Flash Point | 359.2±27.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319-H335 Details |
| Safety Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 3-((2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl)propanamide |