Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (843)-884-4911 | |||
|
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | Benzyl Trichloroacetate |
|---|---|
| Synonyms | 2,2,2-Trichloroacetic Acid Phenylmethyl Ester; 2,2,2-Trichloroacetic Acid Benzyl Ester; Phenylmethyl 2,2,2-Trichloroethanoate |
| Molecular Structure |  |
| Molecular Formula | C9H7Cl3O2 |
| Molecular Weight | 253.51 |
| CAS Registry Number | 26827-38-3 |
| EINECS | 248-017-4 |
| SMILES | C1=C(COC(C(Cl)(Cl)Cl)=O)C=CC=C1 |
| InChI | 1S/C9H7Cl3O2/c10-9(11,12)8(13)14-6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | ATMAFOGHBMIGMV-UHFFFAOYSA-N |
| Density | 1.437g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.967°C at 760 mmHg (Cal.) |
| Flash point | 113.782°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzyl Trichloroacetate |