Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (431) 5606-600 | |||
|
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | (4R)-4-{[(9H-Fluoren-9-Ylmethoxy)Carbonyl]Amino}-6-[(2-Methyl-2-Propanyl)Oxy]-6-Oxohexanoic Acid |
|---|---|
| Synonyms | Fmoc-β-D-HomoGlu-OtBu |
| Molecular Structure | ![CAS#: 268542-16-1， (4R)-4-{[(9H-Fluoren-9-Ylmethoxy)Carbonyl]Amino}-6-[(2-Methyl-2-Propanyl)Oxy]-6-Oxohexanoic Acid](/moreStructures/268542-16-1.gif) |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.50 |
| CAS Registry Number | 268542-16-1 |
| SMILES | O=C(OC(C)(C)C)C[C@H](NC(=O)OCC3c1ccccc1c2c3cccc2)CCC(=O)O |
| InChI | 1S/C25H29NO6/c1-25(2,3)32-23(29)14-16(12-13-22(27)28)26-24(30)31-15-21-19-10-6-4-8-17(19)18-9-5-7-11-20(18)21/h4-11,16,21H,12-15H2,1-3H3,(H,26,30)(H,27,28)/t16-/m1/s1 |
| InChIKey | LZDHCALVMGCTSL-MRXNPFEDSA-N |
| Density | 1.215g/cm3 (Cal.) |
|---|---|
| Boiling point | 646.441°C at 760 mmHg (Cal.) |
| Flash point | 344.756°C (Cal.) |
| Refractive index | 1.566 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4R)-4-{[(9H-Fluoren-9-Ylmethoxy)Carbonyl]Amino}-6-[(2-Methyl-2-Propanyl)Oxy]-6-Oxohexanoic Acid |