Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4-[(4-Oxo-1-Piperidinyl)Carbonyl]Benzonitrile |
|---|---|
| Synonyms | 4-(4-Oxo-piperidine-1-carbonyl)benzonitrile; BENZONITRILE,4-[(4-OXO-1-PIPERIDINYL)CARBONYL]- |
| Molecular Structure | ![CAS#: 268730-72-9， 4-[(4-Oxo-1-Piperidinyl)Carbonyl]Benzonitrile](/moreStructures/268730-72-9.gif) |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 |
| CAS Registry Number | 268730-72-9 |
| SMILES | c1cc(ccc1C#N)C(=O)N2CCC(=O)CC2 |
| InChI | 1S/C13H12N2O2/c14-9-10-1-3-11(4-2-10)13(17)15-7-5-12(16)6-8-15/h1-4H,5-8H2 |
| InChIKey | ZEWMUOQEPSDMTH-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.349°C at 760 mmHg (Cal.) |
| Flash point | 234.63°C (Cal.) |
| Refractive index | 1.594 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Oxo-1-Piperidinyl)Carbonyl]Benzonitrile |