|
CAS#: 26878-89-7 Product: N-Adamantan-1-Yl-Phthalamic Acid No suppilers available for the product. |
| Name | N-Adamantan-1-Yl-Phthalamic Acid |
|---|---|
| Synonyms | 2-[(1-Adamantylamino)-Oxomethyl]Benzoate; Zinc03864724 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20NO3 |
| Molecular Weight | 298.36 |
| CAS Registry Number | 26878-89-7 |
| SMILES | C4=C(C(=O)NC12CC3CC(C1)CC(C2)C3)C(=CC=C4)C([O-])=O |
| InChI | 1S/C18H21NO3/c20-16(14-3-1-2-4-15(14)17(21)22)19-18-8-11-5-12(9-18)7-13(6-11)10-18/h1-4,11-13H,5-10H2,(H,19,20)(H,21,22)/p-1 |
| InChIKey | AFSWJINXXOSCFD-UHFFFAOYSA-M |
| Boiling point | 516.545°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 266.197°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Adamantan-1-Yl-Phthalamic Acid |