Online Database of Chemicals from Around the World
| Oakwood Products, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (800) 467-3386 | |||
 |
k_weaver@oakwoodchemical.com | |||
| Chemical manufacturer | ||||
| Name | N-(2-Chlorophenyl)Benzenecarbohydrazonoyl Chloride |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C13H10Cl2N2 |
| Molecular Weight | 265.14 |
| CAS Registry Number | 26946-54-3 |
| SMILES | Clc2ccccc2N\N=C(\Cl)c1ccccc1 |
| InChI | 1S/C13H10Cl2N2/c14-11-8-4-5-9-12(11)16-17-13(15)10-6-2-1-3-7-10/h1-9,16H/b17-13+ |
| InChIKey | BOGAULFLMDDDIY-GHRIWEEISA-N |
| Density | 1.14-1.34 (Expl.) |
|---|---|
| 1.245g/cm3 (Cal.) | |
| Boiling point | 366.897°C at 760 mmHg (Cal.) |
| Flash point | 175.694°C (Cal.) |
| Refractive index | 1.598 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(2-Chlorophenyl)Benzenecarbohydrazonoyl Chloride |